About (1S)-N,N-dibenzyl-3-methyl-1-[(2R)-oxiran-2-yl]butan-1-amine
(1S)-N,N-dibenzyl-3-methyl-1-[(2R)-oxiran-2-yl]butan-1-amine (PubChem CID 10542928) has the molecular formula C21H27NO
and a molecular weight of 309.45 g/mol. Its IUPAC name is (1S)-N,N-dibenzyl-3-methyl-1-[(2R)-oxiran-2-yl]butan-1-amine.
Molecular Properties
| Compound Name | (1S)-N,N-dibenzyl-3-methyl-1-[(2R)-oxiran-2-yl]butan-1-amine |
| PubChem CID | 10542928 |
| Molecular Formula | C21H27NO |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | (1S)-N,N-dibenzyl-3-methyl-1-[(2R)-oxiran-2-yl]butan-1-amine |
| SMILES | CC(C)C[C@@H]([C@@H]1CO1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C21H27NO/c1-17(2)13-20(21-16-23-21)22(14-18-9-5-3-6-10-18)15-19-11-7-4-8-12-19/h3-12,17,20-21H,13-16H2,1-2H3/t20-,21-/m0/s1 |
| InChIKey | OHLFQONXMDLQNM-SFTDATJTSA-N |
| XLogP | 4.50 |
| TPSA | 15.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (1S)-N,N-dibenzyl-3-methyl-1-[(2R)-oxiran-2-yl]butan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-N,N-dibenzyl-3-methyl-1-[(2R)-oxiran-2-yl]butan-1-amine?
The IUPAC name of (1S)-N,N-dibenzyl-3-methyl-1-[(2R)-oxiran-2-yl]butan-1-amine (CID 10542928) is (1S)-N,N-dibenzyl-3-methyl-1-[(2R)-oxiran-2-yl]butan-1-amine.
What is the SMILES notation for (1S)-N,N-dibenzyl-3-methyl-1-[(2R)-oxiran-2-yl]butan-1-amine?
The canonical SMILES for (1S)-N,N-dibenzyl-3-methyl-1-[(2R)-oxiran-2-yl]butan-1-amine is CC(C)C[C@@H]([C@@H]1CO1)N(Cc1ccccc1)Cc1ccccc1.
What is the InChIKey of (1S)-N,N-dibenzyl-3-methyl-1-[(2R)-oxiran-2-yl]butan-1-amine?
The InChIKey is OHLFQONXMDLQNM-SFTDATJTSA-N. The full InChI is InChI=1S/C21H27NO/c1-17(2)13-20(21-16-23-21)22(14-18-9-5-3-6-10-18)15-19-11-7-4-8-12-19/h3-12,17,20-21H,13-16H2,1-2H3/t20-,21-/m0/s1.
What are the key properties of (1S)-N,N-dibenzyl-3-methyl-1-[(2R)-oxiran-2-yl]butan-1-amine?
(1S)-N,N-dibenzyl-3-methyl-1-[(2R)-oxiran-2-yl]butan-1-amine has a molecular weight of 309.45 g/mol, XLogP of 4.50, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-N,N-dibenzyl-3-methyl-1-[(2R)-oxiran-2-yl]butan-1-amine is sourced from PubChem (CID 10542928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).