C8H10N2O — CID 105429463
5,6,7,8-tetrahydro-2H-2,6-naphthyridin-3-one (PubChem CID 105429463) has the molecular formula C8H10N2O and a molecular weight of 150.18 g/mol. Its IUPAC name is 5,6,7,8-tetrahydro-2H-2,6-naphthyridin-3-one.
| Compound Name | 5,6,7,8-tetrahydro-2H-2,6-naphthyridin-3-one |
|---|---|
| PubChem CID | 105429463 |
| Molecular Formula | C8H10N2O |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.08 |
| IUPAC Name | 5,6,7,8-tetrahydro-2H-2,6-naphthyridin-3-one |
| SMILES | O=c1cc2c(c[nH]1)CCNC2 |
| InChI | InChI=1S/C8H10N2O/c11-8-3-7-4-9-2-1-6(7)5-10-8/h3,5,9H,1-2,4H2,(H,10,11) |
| InChIKey | FBOHLJBPGZIVJN-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |