About 4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-3-ylmethanol
4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-3-ylmethanol (PubChem CID 105429741) has the molecular formula C8H12N2O
and a molecular weight of 152.20 g/mol. Its IUPAC name is 4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-3-ylmethanol.
Analyze 4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-3-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-3-ylmethanol?
The IUPAC name of 4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-3-ylmethanol (CID 105429741) is 4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-3-ylmethanol.
What is the SMILES notation for 4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-3-ylmethanol?
The canonical SMILES for 4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-3-ylmethanol is OCc1cnn2c1CCCC2.
What is the InChIKey of 4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-3-ylmethanol?
The InChIKey is DRVZRONPOKHGMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O/c11-6-7-5-9-10-4-2-1-3-8(7)10/h5,11H,1-4,6H2.
What are the key properties of 4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-3-ylmethanol?
4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-3-ylmethanol has a molecular weight of 152.20 g/mol, XLogP of 0.71, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-3-ylmethanol is sourced from PubChem (CID 105429741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).