About 2-ethyl-1,4,5,6-tetrahydropyrrolo[3,4-c]pyrazol-3-one
2-ethyl-1,4,5,6-tetrahydropyrrolo[3,4-c]pyrazol-3-one (PubChem CID 105429910) has the molecular formula C7H11N3O
and a molecular weight of 153.18 g/mol. Its IUPAC name is 2-ethyl-1,4,5,6-tetrahydropyrrolo[3,4-c]pyrazol-3-one.
Analyze 2-ethyl-1,4,5,6-tetrahydropyrrolo[3,4-c]pyrazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-1,4,5,6-tetrahydropyrrolo[3,4-c]pyrazol-3-one?
The IUPAC name of 2-ethyl-1,4,5,6-tetrahydropyrrolo[3,4-c]pyrazol-3-one (CID 105429910) is 2-ethyl-1,4,5,6-tetrahydropyrrolo[3,4-c]pyrazol-3-one.
What is the SMILES notation for 2-ethyl-1,4,5,6-tetrahydropyrrolo[3,4-c]pyrazol-3-one?
The canonical SMILES for 2-ethyl-1,4,5,6-tetrahydropyrrolo[3,4-c]pyrazol-3-one is CCn1[nH]c2c(c1=O)CNC2.
What is the InChIKey of 2-ethyl-1,4,5,6-tetrahydropyrrolo[3,4-c]pyrazol-3-one?
The InChIKey is HZBOHZDZZDISFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3O/c1-2-10-7(11)5-3-8-4-6(5)9-10/h8-9H,2-4H2,1H3.
What are the key properties of 2-ethyl-1,4,5,6-tetrahydropyrrolo[3,4-c]pyrazol-3-one?
2-ethyl-1,4,5,6-tetrahydropyrrolo[3,4-c]pyrazol-3-one has a molecular weight of 153.18 g/mol, XLogP of -0.20, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-1,4,5,6-tetrahydropyrrolo[3,4-c]pyrazol-3-one is sourced from PubChem (CID 105429910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).