C20H38O2 — CID 10543016
(E,3S,4R,8S,10S,12S)-3-hydroxy-4,6,8,10,12-pentamethylpentadec-6-en-5-one (PubChem CID 10543016) has the molecular formula C20H38O2 and a molecular weight of 310.52 g/mol. Its IUPAC name is (E,3S,4R,8S,10S,12S)-3-hydroxy-4,6,8,10,12-pentamethylpentadec-6-en-5-one.
| Compound Name | (E,3S,4R,8S,10S,12S)-3-hydroxy-4,6,8,10,12-pentamethylpentadec-6-en-5-one |
|---|---|
| PubChem CID | 10543016 |
| Molecular Formula | C20H38O2 |
| Molecular Weight | 310.52 g/mol |
| Exact Mass | 310.29 |
| IUPAC Name | (E,3S,4R,8S,10S,12S)-3-hydroxy-4,6,8,10,12-pentamethylpentadec-6-en-5-one |
| SMILES | CCC[C@H](C)C[C@H](C)C[C@H](C)/C=C(\C)C(=O)[C@H](C)[C@@H](O)CC |
| InChI | InChI=1S/C20H38O2/c1-8-10-14(3)11-15(4)12-16(5)13-17(6)20(22)18(7)19(21)9-2/h13-16,18-19,21H,8-12H2,1-7H3/b17-13+/t14-,15-,16-,18+,19-/m0/s1 |
| InChIKey | NGLXLVUNVHTCIJ-LULJWKSRSA-N |
| XLogP | 5.40 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.52 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|