C6H9N3O2 — CID 105430229
2-(1-aminoethyl)-1H-imidazole-5-carboxylic acid (PubChem CID 105430229) has the molecular formula C6H9N3O2 and a molecular weight of 155.16 g/mol. Its IUPAC name is 2-(1-aminoethyl)-1H-imidazole-5-carboxylic acid.
| Compound Name | 2-(1-aminoethyl)-1H-imidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 105430229 |
| Molecular Formula | C6H9N3O2 |
| Molecular Weight | 155.16 g/mol |
| Exact Mass | 155.07 |
| IUPAC Name | 2-(1-aminoethyl)-1H-imidazole-5-carboxylic acid |
| SMILES | CC(N)c1ncc(C(=O)O)[nH]1 |
| InChI | InChI=1S/C6H9N3O2/c1-3(7)5-8-2-4(9-5)6(10)11/h2-3H,7H2,1H3,(H,8,9)(H,10,11) |
| InChIKey | BIBHWMKSDXENAD-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 92.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.16 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |