About 4-fluoro-1-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-3-amine
4-fluoro-1-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-3-amine (PubChem CID 105430245) has the molecular formula C7H10FN3
and a molecular weight of 155.18 g/mol. Its IUPAC name is 4-fluoro-1-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-3-amine.
Molecular Properties
| Compound Name | 4-fluoro-1-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-3-amine |
| PubChem CID | 105430245 |
| Molecular Formula | C7H10FN3 |
| Molecular Weight | 155.18 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | 4-fluoro-1-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-3-amine |
| SMILES | Cn1nc(N)c2c1CCC2F |
| InChI | InChI=1S/C7H10FN3/c1-11-5-3-2-4(8)6(5)7(9)10-11/h4H,2-3H2,1H3,(H2,9,10) |
| InChIKey | MELMRJYJAUGAKE-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.18 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-fluoro-1-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-1-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-3-amine?
The IUPAC name of 4-fluoro-1-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-3-amine (CID 105430245) is 4-fluoro-1-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-3-amine.
What is the SMILES notation for 4-fluoro-1-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-3-amine?
The canonical SMILES for 4-fluoro-1-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-3-amine is Cn1nc(N)c2c1CCC2F.
What is the InChIKey of 4-fluoro-1-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-3-amine?
The InChIKey is MELMRJYJAUGAKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10FN3/c1-11-5-3-2-4(8)6(5)7(9)10-11/h4H,2-3H2,1H3,(H2,9,10).
What are the key properties of 4-fluoro-1-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-3-amine?
4-fluoro-1-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-3-amine has a molecular weight of 155.18 g/mol, XLogP of 0.96, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-1-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-3-amine is sourced from PubChem (CID 105430245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).