About 3-oxa-7,9-diazabicyclo[3.3.2]decan-10-one
3-oxa-7,9-diazabicyclo[3.3.2]decan-10-one (PubChem CID 105430476) has the molecular formula C7H12N2O2
and a molecular weight of 156.18 g/mol. Its IUPAC name is 3-oxa-7,9-diazabicyclo[3.3.2]decan-10-one.
Molecular Properties
| Compound Name | 3-oxa-7,9-diazabicyclo[3.3.2]decan-10-one |
| PubChem CID | 105430476 |
| Molecular Formula | C7H12N2O2 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.09 |
| IUPAC Name | 3-oxa-7,9-diazabicyclo[3.3.2]decan-10-one |
| SMILES | O=C1NC2CNCC1COC2 |
| InChI | InChI=1S/C7H12N2O2/c10-7-5-1-8-2-6(9-7)4-11-3-5/h5-6,8H,1-4H2,(H,9,10) |
| InChIKey | PQPCHGNXLYYRQR-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-oxa-7,9-diazabicyclo[3.3.2]decan-10-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-oxa-7,9-diazabicyclo[3.3.2]decan-10-one?
The IUPAC name of 3-oxa-7,9-diazabicyclo[3.3.2]decan-10-one (CID 105430476) is 3-oxa-7,9-diazabicyclo[3.3.2]decan-10-one.
What is the SMILES notation for 3-oxa-7,9-diazabicyclo[3.3.2]decan-10-one?
The canonical SMILES for 3-oxa-7,9-diazabicyclo[3.3.2]decan-10-one is O=C1NC2CNCC1COC2.
What is the InChIKey of 3-oxa-7,9-diazabicyclo[3.3.2]decan-10-one?
The InChIKey is PQPCHGNXLYYRQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O2/c10-7-5-1-8-2-6(9-7)4-11-3-5/h5-6,8H,1-4H2,(H,9,10).
What are the key properties of 3-oxa-7,9-diazabicyclo[3.3.2]decan-10-one?
3-oxa-7,9-diazabicyclo[3.3.2]decan-10-one has a molecular weight of 156.18 g/mol, XLogP of -1.28, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxa-7,9-diazabicyclo[3.3.2]decan-10-one is sourced from PubChem (CID 105430476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).