About 8-fluoro-6,8-dimethyl-3,6-diazabicyclo[3.2.1]octane
8-fluoro-6,8-dimethyl-3,6-diazabicyclo[3.2.1]octane (PubChem CID 105431025) has the molecular formula C8H15FN2
and a molecular weight of 158.22 g/mol. Its IUPAC name is 8-fluoro-6,8-dimethyl-3,6-diazabicyclo[3.2.1]octane.
Molecular Properties
| Compound Name | 8-fluoro-6,8-dimethyl-3,6-diazabicyclo[3.2.1]octane |
| PubChem CID | 105431025 |
| Molecular Formula | C8H15FN2 |
| Molecular Weight | 158.22 g/mol |
| Exact Mass | 158.12 |
| IUPAC Name | 8-fluoro-6,8-dimethyl-3,6-diazabicyclo[3.2.1]octane |
| SMILES | CN1CC2CNCC1C2(C)F |
| InChI | InChI=1S/C8H15FN2/c1-8(9)6-3-10-4-7(8)11(2)5-6/h6-7,10H,3-5H2,1-2H3 |
| InChIKey | RETSSCPWGUZQLC-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.22 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-fluoro-6,8-dimethyl-3,6-diazabicyclo[3.2.1]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-fluoro-6,8-dimethyl-3,6-diazabicyclo[3.2.1]octane?
The IUPAC name of 8-fluoro-6,8-dimethyl-3,6-diazabicyclo[3.2.1]octane (CID 105431025) is 8-fluoro-6,8-dimethyl-3,6-diazabicyclo[3.2.1]octane.
What is the SMILES notation for 8-fluoro-6,8-dimethyl-3,6-diazabicyclo[3.2.1]octane?
The canonical SMILES for 8-fluoro-6,8-dimethyl-3,6-diazabicyclo[3.2.1]octane is CN1CC2CNCC1C2(C)F.
What is the InChIKey of 8-fluoro-6,8-dimethyl-3,6-diazabicyclo[3.2.1]octane?
The InChIKey is RETSSCPWGUZQLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15FN2/c1-8(9)6-3-10-4-7(8)11(2)5-6/h6-7,10H,3-5H2,1-2H3.
What are the key properties of 8-fluoro-6,8-dimethyl-3,6-diazabicyclo[3.2.1]octane?
8-fluoro-6,8-dimethyl-3,6-diazabicyclo[3.2.1]octane has a molecular weight of 158.22 g/mol, XLogP of 0.25, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-fluoro-6,8-dimethyl-3,6-diazabicyclo[3.2.1]octane is sourced from PubChem (CID 105431025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).