C6H9NO4 — CID 105431137
3-(3-oxo-1,2-oxazolidin-2-yl)propanoic acid (PubChem CID 105431137) has the molecular formula C6H9NO4 and a molecular weight of 159.14 g/mol. Its IUPAC name is 3-(3-oxo-1,2-oxazolidin-2-yl)propanoic acid.
| Compound Name | 3-(3-oxo-1,2-oxazolidin-2-yl)propanoic acid |
|---|---|
| PubChem CID | 105431137 |
| Molecular Formula | C6H9NO4 |
| Molecular Weight | 159.14 g/mol |
| Exact Mass | 159.05 |
| IUPAC Name | 3-(3-oxo-1,2-oxazolidin-2-yl)propanoic acid |
| SMILES | O=C(O)CCN1OCCC1=O |
| InChI | InChI=1S/C6H9NO4/c8-5-2-4-11-7(5)3-1-6(9)10/h1-4H2,(H,9,10) |
| InChIKey | JTHYICYGGFVFOT-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.14 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |