3-(3-oxo-1,2-oxazolidin-2-yl)propanoic acid

C6H9NO4 — CID 105431137

IUPAC3-(3-oxo-1,2-oxazolidin-2-yl)propanoic acid
SMILESO=C(O)CCN1OCCC1=O
InChIInChI=1S/C6H9NO4/c8-5-2-4-11-7(5)3-1-6(9)10/h1-4H2,(H,9,10)
InChIKeyJTHYICYGGFVFOT-UHFFFAOYSA-N
MW159.14 g/mol
LogP-0.38
Rot. Bonds3

About 3-(3-oxo-1,2-oxazolidin-2-yl)propanoic acid

3-(3-oxo-1,2-oxazolidin-2-yl)propanoic acid (PubChem CID 105431137) has the molecular formula C6H9NO4 and a molecular weight of 159.14 g/mol. Its IUPAC name is 3-(3-oxo-1,2-oxazolidin-2-yl)propanoic acid.

Molecular Properties

Compound Name3-(3-oxo-1,2-oxazolidin-2-yl)propanoic acid
PubChem CID105431137
Molecular FormulaC6H9NO4
Molecular Weight159.14 g/mol
Exact Mass159.05
IUPAC Name3-(3-oxo-1,2-oxazolidin-2-yl)propanoic acid
SMILESO=C(O)CCN1OCCC1=O
InChIInChI=1S/C6H9NO4/c8-5-2-4-11-7(5)3-1-6(9)10/h1-4H2,(H,9,10)
InChIKeyJTHYICYGGFVFOT-UHFFFAOYSA-N
XLogP-0.38
TPSA66.84 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500159.14
LogP ≤ 5-0.38
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-(3-oxo-1,2-oxazolidin-2-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(3-oxo-1,2-oxazolidin-2-yl)propanoic acid?
The IUPAC name of 3-(3-oxo-1,2-oxazolidin-2-yl)propanoic acid (CID 105431137) is 3-(3-oxo-1,2-oxazolidin-2-yl)propanoic acid.
What is the SMILES notation for 3-(3-oxo-1,2-oxazolidin-2-yl)propanoic acid?
The canonical SMILES for 3-(3-oxo-1,2-oxazolidin-2-yl)propanoic acid is O=C(O)CCN1OCCC1=O.
What is the InChIKey of 3-(3-oxo-1,2-oxazolidin-2-yl)propanoic acid?
The InChIKey is JTHYICYGGFVFOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO4/c8-5-2-4-11-7(5)3-1-6(9)10/h1-4H2,(H,9,10).
What are the key properties of 3-(3-oxo-1,2-oxazolidin-2-yl)propanoic acid?
3-(3-oxo-1,2-oxazolidin-2-yl)propanoic acid has a molecular weight of 159.14 g/mol, XLogP of -0.38, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-oxo-1,2-oxazolidin-2-yl)propanoic acid is sourced from PubChem (CID 105431137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).