C4H9N5S — CID 105431241
2-N-(2-aminoethyl)-1,3,4-thiadiazole-2,5-diamine (PubChem CID 105431241) has the molecular formula C4H9N5S and a molecular weight of 159.22 g/mol. Its IUPAC name is 2-N-(2-aminoethyl)-1,3,4-thiadiazole-2,5-diamine.
| Compound Name | 2-N-(2-aminoethyl)-1,3,4-thiadiazole-2,5-diamine |
|---|---|
| PubChem CID | 105431241 |
| Molecular Formula | C4H9N5S |
| Molecular Weight | 159.22 g/mol |
| Exact Mass | 159.06 |
| IUPAC Name | 2-N-(2-aminoethyl)-1,3,4-thiadiazole-2,5-diamine |
| SMILES | NCCNc1nnc(N)s1 |
| InChI | InChI=1S/C4H9N5S/c5-1-2-7-4-9-8-3(6)10-4/h1-2,5H2,(H2,6,8)(H,7,9) |
| InChIKey | FOZUBMLZSQHXGU-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.22 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |