About 3-methyl-2,1-benzoxazole-6-carbaldehyde
3-methyl-2,1-benzoxazole-6-carbaldehyde (PubChem CID 105431537) has the molecular formula C9H7NO2
and a molecular weight of 161.16 g/mol. Its IUPAC name is 3-methyl-2,1-benzoxazole-6-carbaldehyde.
Molecular Properties
| Compound Name | 3-methyl-2,1-benzoxazole-6-carbaldehyde |
| PubChem CID | 105431537 |
| Molecular Formula | C9H7NO2 |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.05 |
| IUPAC Name | 3-methyl-2,1-benzoxazole-6-carbaldehyde |
| SMILES | Cc1onc2cc(C=O)ccc12 |
| InChI | InChI=1S/C9H7NO2/c1-6-8-3-2-7(5-11)4-9(8)10-12-6/h2-5H,1H3 |
| InChIKey | DBDUMFDDXMUMEK-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-2,1-benzoxazole-6-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-2,1-benzoxazole-6-carbaldehyde?
The IUPAC name of 3-methyl-2,1-benzoxazole-6-carbaldehyde (CID 105431537) is 3-methyl-2,1-benzoxazole-6-carbaldehyde.
What is the SMILES notation for 3-methyl-2,1-benzoxazole-6-carbaldehyde?
The canonical SMILES for 3-methyl-2,1-benzoxazole-6-carbaldehyde is Cc1onc2cc(C=O)ccc12.
What is the InChIKey of 3-methyl-2,1-benzoxazole-6-carbaldehyde?
The InChIKey is DBDUMFDDXMUMEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO2/c1-6-8-3-2-7(5-11)4-9(8)10-12-6/h2-5H,1H3.
What are the key properties of 3-methyl-2,1-benzoxazole-6-carbaldehyde?
3-methyl-2,1-benzoxazole-6-carbaldehyde has a molecular weight of 161.16 g/mol, XLogP of 1.95, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2,1-benzoxazole-6-carbaldehyde is sourced from PubChem (CID 105431537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).