About 2-imidazo[1,5-a]pyrimidin-6-ylethanamine
2-imidazo[1,5-a]pyrimidin-6-ylethanamine (PubChem CID 105431897) has the molecular formula C8H10N4
and a molecular weight of 162.20 g/mol. Its IUPAC name is 2-imidazo[1,5-a]pyrimidin-6-ylethanamine.
Molecular Properties
| Compound Name | 2-imidazo[1,5-a]pyrimidin-6-ylethanamine |
| PubChem CID | 105431897 |
| Molecular Formula | C8H10N4 |
| Molecular Weight | 162.20 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | 2-imidazo[1,5-a]pyrimidin-6-ylethanamine |
| SMILES | NCCc1ncc2ncccn12 |
| InChI | InChI=1S/C8H10N4/c9-3-2-7-11-6-8-10-4-1-5-12(7)8/h1,4-6H,2-3,9H2 |
| InChIKey | PHSLAOZFQPGXQT-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.20 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-imidazo[1,5-a]pyrimidin-6-ylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-imidazo[1,5-a]pyrimidin-6-ylethanamine?
The IUPAC name of 2-imidazo[1,5-a]pyrimidin-6-ylethanamine (CID 105431897) is 2-imidazo[1,5-a]pyrimidin-6-ylethanamine.
What is the SMILES notation for 2-imidazo[1,5-a]pyrimidin-6-ylethanamine?
The canonical SMILES for 2-imidazo[1,5-a]pyrimidin-6-ylethanamine is NCCc1ncc2ncccn12.
What is the InChIKey of 2-imidazo[1,5-a]pyrimidin-6-ylethanamine?
The InChIKey is PHSLAOZFQPGXQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4/c9-3-2-7-11-6-8-10-4-1-5-12(7)8/h1,4-6H,2-3,9H2.
What are the key properties of 2-imidazo[1,5-a]pyrimidin-6-ylethanamine?
2-imidazo[1,5-a]pyrimidin-6-ylethanamine has a molecular weight of 162.20 g/mol, XLogP of 0.23, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-imidazo[1,5-a]pyrimidin-6-ylethanamine is sourced from PubChem (CID 105431897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).