About 3-(aminomethyl)imidazo[1,5-a]pyridin-6-ol
3-(aminomethyl)imidazo[1,5-a]pyridin-6-ol (PubChem CID 105432043) has the molecular formula C8H9N3O
and a molecular weight of 163.18 g/mol. Its IUPAC name is 3-(aminomethyl)imidazo[1,5-a]pyridin-6-ol.
Molecular Properties
| Compound Name | 3-(aminomethyl)imidazo[1,5-a]pyridin-6-ol |
| PubChem CID | 105432043 |
| Molecular Formula | C8H9N3O |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.07 |
| IUPAC Name | 3-(aminomethyl)imidazo[1,5-a]pyridin-6-ol |
| SMILES | NCc1ncc2ccc(O)cn12 |
| InChI | InChI=1S/C8H9N3O/c9-3-8-10-4-6-1-2-7(12)5-11(6)8/h1-2,4-5,12H,3,9H2 |
| InChIKey | BFWALTCXXYMNQT-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 63.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(aminomethyl)imidazo[1,5-a]pyridin-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(aminomethyl)imidazo[1,5-a]pyridin-6-ol?
The IUPAC name of 3-(aminomethyl)imidazo[1,5-a]pyridin-6-ol (CID 105432043) is 3-(aminomethyl)imidazo[1,5-a]pyridin-6-ol.
What is the SMILES notation for 3-(aminomethyl)imidazo[1,5-a]pyridin-6-ol?
The canonical SMILES for 3-(aminomethyl)imidazo[1,5-a]pyridin-6-ol is NCc1ncc2ccc(O)cn12.
What is the InChIKey of 3-(aminomethyl)imidazo[1,5-a]pyridin-6-ol?
The InChIKey is BFWALTCXXYMNQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3O/c9-3-8-10-4-6-1-2-7(12)5-11(6)8/h1-2,4-5,12H,3,9H2.
What are the key properties of 3-(aminomethyl)imidazo[1,5-a]pyridin-6-ol?
3-(aminomethyl)imidazo[1,5-a]pyridin-6-ol has a molecular weight of 163.18 g/mol, XLogP of 0.50, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(aminomethyl)imidazo[1,5-a]pyridin-6-ol is sourced from PubChem (CID 105432043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).