C19H23NO3 — CID 10543210
5-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-1,2-oxazole-3-carboxylic acid (PubChem CID 10543210) has the molecular formula C19H23NO3 and a molecular weight of 313.40 g/mol. Its IUPAC name is 5-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-1,2-oxazole-3-carboxylic acid.
| Compound Name | 5-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-1,2-oxazole-3-carboxylic acid |
|---|---|
| PubChem CID | 10543210 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | 5-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-1,2-oxazole-3-carboxylic acid |
| SMILES | Cc1cc2c(cc1-c1cc(C(=O)O)no1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C19H23NO3/c1-11-8-13-14(19(4,5)7-6-18(13,2)3)9-12(11)16-10-15(17(21)22)20-23-16/h8-10H,6-7H2,1-5H3,(H,21,22) |
| InChIKey | SOHWQOITYAGDRG-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |