About 3-(4-methylphenyl)-1,2-oxazolidine
3-(4-methylphenyl)-1,2-oxazolidine (PubChem CID 105432193) has the molecular formula C10H13NO
and a molecular weight of 163.22 g/mol. Its IUPAC name is 3-(4-methylphenyl)-1,2-oxazolidine.
Molecular Properties
| Compound Name | 3-(4-methylphenyl)-1,2-oxazolidine |
| PubChem CID | 105432193 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | 3-(4-methylphenyl)-1,2-oxazolidine |
| SMILES | Cc1ccc(C2CCON2)cc1 |
| InChI | InChI=1S/C10H13NO/c1-8-2-4-9(5-3-8)10-6-7-12-11-10/h2-5,10-11H,6-7H2,1H3 |
| InChIKey | FYXXPFUAWLJILO-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(4-methylphenyl)-1,2-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-methylphenyl)-1,2-oxazolidine?
The IUPAC name of 3-(4-methylphenyl)-1,2-oxazolidine (CID 105432193) is 3-(4-methylphenyl)-1,2-oxazolidine.
What is the SMILES notation for 3-(4-methylphenyl)-1,2-oxazolidine?
The canonical SMILES for 3-(4-methylphenyl)-1,2-oxazolidine is Cc1ccc(C2CCON2)cc1.
What is the InChIKey of 3-(4-methylphenyl)-1,2-oxazolidine?
The InChIKey is FYXXPFUAWLJILO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO/c1-8-2-4-9(5-3-8)10-6-7-12-11-10/h2-5,10-11H,6-7H2,1H3.
What are the key properties of 3-(4-methylphenyl)-1,2-oxazolidine?
3-(4-methylphenyl)-1,2-oxazolidine has a molecular weight of 163.22 g/mol, XLogP of 1.96, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-methylphenyl)-1,2-oxazolidine is sourced from PubChem (CID 105432193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).