About 2-methoxy-2,3-dihydro-1H-inden-4-amine
2-methoxy-2,3-dihydro-1H-inden-4-amine (PubChem CID 105432211) has the molecular formula C10H13NO
and a molecular weight of 163.22 g/mol. Its IUPAC name is 2-methoxy-2,3-dihydro-1H-inden-4-amine.
Molecular Properties
| Compound Name | 2-methoxy-2,3-dihydro-1H-inden-4-amine |
| PubChem CID | 105432211 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | 2-methoxy-2,3-dihydro-1H-inden-4-amine |
| SMILES | COC1Cc2cccc(N)c2C1 |
| InChI | InChI=1S/C10H13NO/c1-12-8-5-7-3-2-4-10(11)9(7)6-8/h2-4,8H,5-6,11H2,1H3 |
| InChIKey | CMHJQVLWDCLFJR-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxy-2,3-dihydro-1H-inden-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-2,3-dihydro-1H-inden-4-amine?
The IUPAC name of 2-methoxy-2,3-dihydro-1H-inden-4-amine (CID 105432211) is 2-methoxy-2,3-dihydro-1H-inden-4-amine.
What is the SMILES notation for 2-methoxy-2,3-dihydro-1H-inden-4-amine?
The canonical SMILES for 2-methoxy-2,3-dihydro-1H-inden-4-amine is COC1Cc2cccc(N)c2C1.
What is the InChIKey of 2-methoxy-2,3-dihydro-1H-inden-4-amine?
The InChIKey is CMHJQVLWDCLFJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO/c1-12-8-5-7-3-2-4-10(11)9(7)6-8/h2-4,8H,5-6,11H2,1H3.
What are the key properties of 2-methoxy-2,3-dihydro-1H-inden-4-amine?
2-methoxy-2,3-dihydro-1H-inden-4-amine has a molecular weight of 163.22 g/mol, XLogP of 1.38, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-2,3-dihydro-1H-inden-4-amine is sourced from PubChem (CID 105432211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).