About 7-(aminomethyl)-1H-2,1-benzoxazol-3-one
7-(aminomethyl)-1H-2,1-benzoxazol-3-one (PubChem CID 105432314) has the molecular formula C8H8N2O2
and a molecular weight of 164.16 g/mol. Its IUPAC name is 7-(aminomethyl)-1H-2,1-benzoxazol-3-one.
Molecular Properties
| Compound Name | 7-(aminomethyl)-1H-2,1-benzoxazol-3-one |
| PubChem CID | 105432314 |
| Molecular Formula | C8H8N2O2 |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.06 |
| IUPAC Name | 7-(aminomethyl)-1H-2,1-benzoxazol-3-one |
| SMILES | NCc1cccc2c(=O)o[nH]c12 |
| InChI | InChI=1S/C8H8N2O2/c9-4-5-2-1-3-6-7(5)10-12-8(6)11/h1-3,10H,4,9H2 |
| InChIKey | AXXUMUQZQDGFQP-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 72.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-(aminomethyl)-1H-2,1-benzoxazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(aminomethyl)-1H-2,1-benzoxazol-3-one?
The IUPAC name of 7-(aminomethyl)-1H-2,1-benzoxazol-3-one (CID 105432314) is 7-(aminomethyl)-1H-2,1-benzoxazol-3-one.
What is the SMILES notation for 7-(aminomethyl)-1H-2,1-benzoxazol-3-one?
The canonical SMILES for 7-(aminomethyl)-1H-2,1-benzoxazol-3-one is NCc1cccc2c(=O)o[nH]c12.
What is the InChIKey of 7-(aminomethyl)-1H-2,1-benzoxazol-3-one?
The InChIKey is AXXUMUQZQDGFQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O2/c9-4-5-2-1-3-6-7(5)10-12-8(6)11/h1-3,10H,4,9H2.
What are the key properties of 7-(aminomethyl)-1H-2,1-benzoxazol-3-one?
7-(aminomethyl)-1H-2,1-benzoxazol-3-one has a molecular weight of 164.16 g/mol, XLogP of 0.58, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(aminomethyl)-1H-2,1-benzoxazol-3-one is sourced from PubChem (CID 105432314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).