C12H15IN2 — CID 10543240
2-tert-butyl-3-iodo-7-methylimidazo[1,2-a]pyridine (PubChem CID 10543240) has the molecular formula C12H15IN2 and a molecular weight of 314.17 g/mol. Its IUPAC name is 2-tert-butyl-3-iodo-7-methylimidazo[1,2-a]pyridine.
| Compound Name | 2-tert-butyl-3-iodo-7-methylimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 10543240 |
| Molecular Formula | C12H15IN2 |
| Molecular Weight | 314.17 g/mol |
| Exact Mass | 314.03 |
| IUPAC Name | 2-tert-butyl-3-iodo-7-methylimidazo[1,2-a]pyridine |
| SMILES | Cc1ccn2c(I)c(C(C)(C)C)nc2c1 |
| InChI | InChI=1S/C12H15IN2/c1-8-5-6-15-9(7-8)14-10(11(15)13)12(2,3)4/h5-7H,1-4H3 |
| InChIKey | BSDXHYSYPUOZIT-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.17 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|