About 2-(6,7-dihydro-5H-cyclopenta[e][1,2,4]triazin-3-yl)ethanol
2-(6,7-dihydro-5H-cyclopenta[e][1,2,4]triazin-3-yl)ethanol (PubChem CID 105432686) has the molecular formula C8H11N3O
and a molecular weight of 165.20 g/mol. Its IUPAC name is 2-(6,7-dihydro-5H-cyclopenta[e][1,2,4]triazin-3-yl)ethanol.
Molecular Properties
| Compound Name | 2-(6,7-dihydro-5H-cyclopenta[e][1,2,4]triazin-3-yl)ethanol |
| PubChem CID | 105432686 |
| Molecular Formula | C8H11N3O |
| Molecular Weight | 165.20 g/mol |
| Exact Mass | 165.09 |
| IUPAC Name | 2-(6,7-dihydro-5H-cyclopenta[e][1,2,4]triazin-3-yl)ethanol |
| SMILES | OCCc1nnc2c(n1)CCC2 |
| InChI | InChI=1S/C8H11N3O/c12-5-4-8-9-6-2-1-3-7(6)10-11-8/h12H,1-5H2 |
| InChIKey | SDRQVCRDBSXQII-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 58.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.20 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(6,7-dihydro-5H-cyclopenta[e][1,2,4]triazin-3-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6,7-dihydro-5H-cyclopenta[e][1,2,4]triazin-3-yl)ethanol?
The IUPAC name of 2-(6,7-dihydro-5H-cyclopenta[e][1,2,4]triazin-3-yl)ethanol (CID 105432686) is 2-(6,7-dihydro-5H-cyclopenta[e][1,2,4]triazin-3-yl)ethanol.
What is the SMILES notation for 2-(6,7-dihydro-5H-cyclopenta[e][1,2,4]triazin-3-yl)ethanol?
The canonical SMILES for 2-(6,7-dihydro-5H-cyclopenta[e][1,2,4]triazin-3-yl)ethanol is OCCc1nnc2c(n1)CCC2.
What is the InChIKey of 2-(6,7-dihydro-5H-cyclopenta[e][1,2,4]triazin-3-yl)ethanol?
The InChIKey is SDRQVCRDBSXQII-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O/c12-5-4-8-9-6-2-1-3-7(6)10-11-8/h12H,1-5H2.
What are the key properties of 2-(6,7-dihydro-5H-cyclopenta[e][1,2,4]triazin-3-yl)ethanol?
2-(6,7-dihydro-5H-cyclopenta[e][1,2,4]triazin-3-yl)ethanol has a molecular weight of 165.20 g/mol, XLogP of -0.10, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6,7-dihydro-5H-cyclopenta[e][1,2,4]triazin-3-yl)ethanol is sourced from PubChem (CID 105432686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).