C8H9FN2O — CID 105433699
4-fluoro-4,5,6,7-tetrahydro-1H-indazole-3-carbaldehyde (PubChem CID 105433699) has the molecular formula C8H9FN2O and a molecular weight of 168.17 g/mol. Its IUPAC name is 4-fluoro-4,5,6,7-tetrahydro-1H-indazole-3-carbaldehyde.
| Compound Name | 4-fluoro-4,5,6,7-tetrahydro-1H-indazole-3-carbaldehyde |
|---|---|
| PubChem CID | 105433699 |
| Molecular Formula | C8H9FN2O |
| Molecular Weight | 168.17 g/mol |
| Exact Mass | 168.07 |
| IUPAC Name | 4-fluoro-4,5,6,7-tetrahydro-1H-indazole-3-carbaldehyde |
| SMILES | O=Cc1n[nH]c2c1C(F)CCC2 |
| InChI | InChI=1S/C8H9FN2O/c9-5-2-1-3-6-8(5)7(4-12)11-10-6/h4-5H,1-3H2,(H,10,11) |
| InChIKey | JVLMTKHFQQZHDK-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.17 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|