C6H10F2OS — CID 105433783
2-(4,4-difluorothiolan-3-yl)ethanol (PubChem CID 105433783) has the molecular formula C6H10F2OS and a molecular weight of 168.21 g/mol. Its IUPAC name is 2-(4,4-difluorothiolan-3-yl)ethanol.
| Compound Name | 2-(4,4-difluorothiolan-3-yl)ethanol |
|---|---|
| PubChem CID | 105433783 |
| Molecular Formula | C6H10F2OS |
| Molecular Weight | 168.21 g/mol |
| Exact Mass | 168.04 |
| IUPAC Name | 2-(4,4-difluorothiolan-3-yl)ethanol |
| SMILES | OCCC1CSCC1(F)F |
| InChI | InChI=1S/C6H10F2OS/c7-6(8)4-10-3-5(6)1-2-9/h5,9H,1-4H2 |
| InChIKey | ZPFABRJURONUAB-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.21 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |