C20H29NO2 — CID 10543384
(8R,9S,13S,14S,17S)-4-(2-aminoethyl)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol (PubChem CID 10543384) has the molecular formula C20H29NO2 and a molecular weight of 315.46 g/mol. Its IUPAC name is (8R,9S,13S,14S,17S)-4-(2-aminoethyl)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (8R,9S,13S,14S,17S)-4-(2-aminoethyl)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 10543384 |
| Molecular Formula | C20H29NO2 |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.22 |
| IUPAC Name | (8R,9S,13S,14S,17S)-4-(2-aminoethyl)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
| SMILES | C[C@]12CC[C@@H]3c4ccc(O)c(CCN)c4CC[C@H]3[C@@H]1CC[C@@H]2O |
| InChI | InChI=1S/C20H29NO2/c1-20-10-8-14-12-4-6-18(22)16(9-11-21)13(12)2-3-15(14)17(20)5-7-19(20)23/h4,6,14-15,17,19,22-23H,2-3,5,7-11,21H2,1H3/t14-,15-,17+,19+,20+/m1/s1 |
| InChIKey | GPXWCTMPQHAUGA-VCNAKFCDSA-N |
| XLogP | 3.11 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |