5-methyl-2,5-diazabicyclo[2.2.2]octane-1-carboxylic acid

C8H14N2O2 — CID 105434528

IUPAC5-methyl-2,5-diazabicyclo[2.2.2]octane-1-carboxylic acid
SMILESCN1CC2(C(=O)O)CCC1CN2
InChIInChI=1S/C8H14N2O2/c1-10-5-8(7(11)12)3-2-6(10)4-9-8/h6,9H,2-5H2,1H3,(H,11,12)
InChIKeyINLUZUNULIJOJX-UHFFFAOYSA-N
MW170.21 g/mol
LogP-0.49
Rot. Bonds1

About 5-methyl-2,5-diazabicyclo[2.2.2]octane-1-carboxylic acid

5-methyl-2,5-diazabicyclo[2.2.2]octane-1-carboxylic acid (PubChem CID 105434528) has the molecular formula C8H14N2O2 and a molecular weight of 170.21 g/mol. Its IUPAC name is 5-methyl-2,5-diazabicyclo[2.2.2]octane-1-carboxylic acid.

Molecular Properties

Compound Name5-methyl-2,5-diazabicyclo[2.2.2]octane-1-carboxylic acid
PubChem CID105434528
Molecular FormulaC8H14N2O2
Molecular Weight170.21 g/mol
Exact Mass170.11
IUPAC Name5-methyl-2,5-diazabicyclo[2.2.2]octane-1-carboxylic acid
SMILESCN1CC2(C(=O)O)CCC1CN2
InChIInChI=1S/C8H14N2O2/c1-10-5-8(7(11)12)3-2-6(10)4-9-8/h6,9H,2-5H2,1H3,(H,11,12)
InChIKeyINLUZUNULIJOJX-UHFFFAOYSA-N
XLogP-0.49
TPSA52.57 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500170.21
LogP ≤ 5-0.49
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 5-methyl-2,5-diazabicyclo[2.2.2]octane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-methyl-2,5-diazabicyclo[2.2.2]octane-1-carboxylic acid?
The IUPAC name of 5-methyl-2,5-diazabicyclo[2.2.2]octane-1-carboxylic acid (CID 105434528) is 5-methyl-2,5-diazabicyclo[2.2.2]octane-1-carboxylic acid.
What is the SMILES notation for 5-methyl-2,5-diazabicyclo[2.2.2]octane-1-carboxylic acid?
The canonical SMILES for 5-methyl-2,5-diazabicyclo[2.2.2]octane-1-carboxylic acid is CN1CC2(C(=O)O)CCC1CN2.
What is the InChIKey of 5-methyl-2,5-diazabicyclo[2.2.2]octane-1-carboxylic acid?
The InChIKey is INLUZUNULIJOJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O2/c1-10-5-8(7(11)12)3-2-6(10)4-9-8/h6,9H,2-5H2,1H3,(H,11,12).
What are the key properties of 5-methyl-2,5-diazabicyclo[2.2.2]octane-1-carboxylic acid?
5-methyl-2,5-diazabicyclo[2.2.2]octane-1-carboxylic acid has a molecular weight of 170.21 g/mol, XLogP of -0.49, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2,5-diazabicyclo[2.2.2]octane-1-carboxylic acid is sourced from PubChem (CID 105434528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).