C20H28O3 — CID 10543458
(1S,4S,9S,10S,14S)-5,5,9,16-tetramethyl-13-oxatetracyclo[8.7.0.01,14.04,9]heptadec-15-ene-6,12-dione (PubChem CID 10543458) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is (1S,4S,9S,10S,14S)-5,5,9,16-tetramethyl-13-oxatetracyclo[8.7.0.01,14.04,9]heptadec-15-ene-6,12-dione.
| Compound Name | (1S,4S,9S,10S,14S)-5,5,9,16-tetramethyl-13-oxatetracyclo[8.7.0.01,14.04,9]heptadec-15-ene-6,12-dione |
|---|---|
| PubChem CID | 10543458 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | (1S,4S,9S,10S,14S)-5,5,9,16-tetramethyl-13-oxatetracyclo[8.7.0.01,14.04,9]heptadec-15-ene-6,12-dione |
| SMILES | CC1=C[C@@H]2OC(=O)C[C@H]3[C@]4(C)CCC(=O)C(C)(C)[C@H]4CC[C@@]23C1 |
| InChI | InChI=1S/C20H28O3/c1-12-9-16-20(11-12)8-5-13-18(2,3)15(21)6-7-19(13,4)14(20)10-17(22)23-16/h9,13-14,16H,5-8,10-11H2,1-4H3/t13-,14+,16+,19-,20+/m1/s1 |
| InChIKey | HORXECAIWALMQC-FCDLBOHZSA-N |
| XLogP | 4.06 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|