About 6-fluoro-5,6-dihydro-4H-cyclopenta[d][1,2]oxazole-3-carboxylic acid
6-fluoro-5,6-dihydro-4H-cyclopenta[d][1,2]oxazole-3-carboxylic acid (PubChem CID 105434647) has the molecular formula C7H6FNO3
and a molecular weight of 171.13 g/mol. Its IUPAC name is 6-fluoro-5,6-dihydro-4H-cyclopenta[d][1,2]oxazole-3-carboxylic acid.
Molecular Properties
| Compound Name | 6-fluoro-5,6-dihydro-4H-cyclopenta[d][1,2]oxazole-3-carboxylic acid |
| PubChem CID | 105434647 |
| Molecular Formula | C7H6FNO3 |
| Molecular Weight | 171.13 g/mol |
| Exact Mass | 171.03 |
| IUPAC Name | 6-fluoro-5,6-dihydro-4H-cyclopenta[d][1,2]oxazole-3-carboxylic acid |
| SMILES | O=C(O)c1noc2c1CCC2F |
| InChI | InChI=1S/C7H6FNO3/c8-4-2-1-3-5(7(10)11)9-12-6(3)4/h4H,1-2H2,(H,10,11) |
| InChIKey | XNWULSSDZXOPSA-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.13 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-fluoro-5,6-dihydro-4H-cyclopenta[d][1,2]oxazole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-5,6-dihydro-4H-cyclopenta[d][1,2]oxazole-3-carboxylic acid?
The IUPAC name of 6-fluoro-5,6-dihydro-4H-cyclopenta[d][1,2]oxazole-3-carboxylic acid (CID 105434647) is 6-fluoro-5,6-dihydro-4H-cyclopenta[d][1,2]oxazole-3-carboxylic acid.
What is the SMILES notation for 6-fluoro-5,6-dihydro-4H-cyclopenta[d][1,2]oxazole-3-carboxylic acid?
The canonical SMILES for 6-fluoro-5,6-dihydro-4H-cyclopenta[d][1,2]oxazole-3-carboxylic acid is O=C(O)c1noc2c1CCC2F.
What is the InChIKey of 6-fluoro-5,6-dihydro-4H-cyclopenta[d][1,2]oxazole-3-carboxylic acid?
The InChIKey is XNWULSSDZXOPSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6FNO3/c8-4-2-1-3-5(7(10)11)9-12-6(3)4/h4H,1-2H2,(H,10,11).
What are the key properties of 6-fluoro-5,6-dihydro-4H-cyclopenta[d][1,2]oxazole-3-carboxylic acid?
6-fluoro-5,6-dihydro-4H-cyclopenta[d][1,2]oxazole-3-carboxylic acid has a molecular weight of 171.13 g/mol, XLogP of 1.33, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-5,6-dihydro-4H-cyclopenta[d][1,2]oxazole-3-carboxylic acid is sourced from PubChem (CID 105434647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).