C20H25NO2 — CID 10543511
(1R,2R,4S,9S,11R)-2,12,12-trimethyl-4-phenyl-3-oxa-8-azatetracyclo[9.1.1.02,9.04,8]tridecan-7-one (PubChem CID 10543511) has the molecular formula C20H25NO2 and a molecular weight of 311.42 g/mol. Its IUPAC name is (1R,2R,4S,9S,11R)-2,12,12-trimethyl-4-phenyl-3-oxa-8-azatetracyclo[9.1.1.02,9.04,8]tridecan-7-one.
| Compound Name | (1R,2R,4S,9S,11R)-2,12,12-trimethyl-4-phenyl-3-oxa-8-azatetracyclo[9.1.1.02,9.04,8]tridecan-7-one |
|---|---|
| PubChem CID | 10543511 |
| Molecular Formula | C20H25NO2 |
| Molecular Weight | 311.42 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | (1R,2R,4S,9S,11R)-2,12,12-trimethyl-4-phenyl-3-oxa-8-azatetracyclo[9.1.1.02,9.04,8]tridecan-7-one |
| SMILES | CC1(C)[C@H]2C[C@@H]3N4C(=O)CC[C@@]4(c4ccccc4)O[C@]3(C)[C@@H]1C2 |
| InChI | InChI=1S/C20H25NO2/c1-18(2)14-11-15(18)19(3)16(12-14)21-17(22)9-10-20(21,23-19)13-7-5-4-6-8-13/h4-8,14-16H,9-12H2,1-3H3/t14-,15-,16+,19-,20+/m1/s1 |
| InChIKey | BTMXCHLTORTFCA-WVPQZDDBSA-N |
| XLogP | 3.69 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.42 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |