About 1λ6-thia-7-azaspiro[4.4]nonane 1,1-dioxide
1λ6-thia-7-azaspiro[4.4]nonane 1,1-dioxide (PubChem CID 105436280) has the molecular formula C7H13NO2S
and a molecular weight of 175.25 g/mol. Its IUPAC name is 1λ6-thia-7-azaspiro[4.4]nonane 1,1-dioxide.
Molecular Properties
| Compound Name | 1λ6-thia-7-azaspiro[4.4]nonane 1,1-dioxide |
| PubChem CID | 105436280 |
| Molecular Formula | C7H13NO2S |
| Molecular Weight | 175.25 g/mol |
| Exact Mass | 175.07 |
| IUPAC Name | 1λ6-thia-7-azaspiro[4.4]nonane 1,1-dioxide |
| SMILES | O=S1(=O)CCCC12CCNC2 |
| InChI | InChI=1S/C7H13NO2S/c9-11(10)5-1-2-7(11)3-4-8-6-7/h8H,1-6H2 |
| InChIKey | FDRGMYKYAGTUFB-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.25 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1λ6-thia-7-azaspiro[4.4]nonane 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1λ6-thia-7-azaspiro[4.4]nonane 1,1-dioxide?
The IUPAC name of 1λ6-thia-7-azaspiro[4.4]nonane 1,1-dioxide (CID 105436280) is 1λ6-thia-7-azaspiro[4.4]nonane 1,1-dioxide.
What is the SMILES notation for 1λ6-thia-7-azaspiro[4.4]nonane 1,1-dioxide?
The canonical SMILES for 1λ6-thia-7-azaspiro[4.4]nonane 1,1-dioxide is O=S1(=O)CCCC12CCNC2.
What is the InChIKey of 1λ6-thia-7-azaspiro[4.4]nonane 1,1-dioxide?
The InChIKey is FDRGMYKYAGTUFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO2S/c9-11(10)5-1-2-7(11)3-4-8-6-7/h8H,1-6H2.
What are the key properties of 1λ6-thia-7-azaspiro[4.4]nonane 1,1-dioxide?
1λ6-thia-7-azaspiro[4.4]nonane 1,1-dioxide has a molecular weight of 175.25 g/mol, XLogP of -0.07, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1λ6-thia-7-azaspiro[4.4]nonane 1,1-dioxide is sourced from PubChem (CID 105436280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).