C20H33NO2 — CID 10543649
[(1R,3aR,4S,7aS)-7a-cyano-1-[(2R)-6-methylheptan-2-yl]-1,2,3,3a,4,5,6,7-octahydroinden-4-yl] acetate (PubChem CID 10543649) has the molecular formula C20H33NO2 and a molecular weight of 319.49 g/mol. Its IUPAC name is [(1R,3aR,4S,7aS)-7a-cyano-1-[(2R)-6-methylheptan-2-yl]-1,2,3,3a,4,5,6,7-octahydroinden-4-yl] acetate.
| Compound Name | [(1R,3aR,4S,7aS)-7a-cyano-1-[(2R)-6-methylheptan-2-yl]-1,2,3,3a,4,5,6,7-octahydroinden-4-yl] acetate |
|---|---|
| PubChem CID | 10543649 |
| Molecular Formula | C20H33NO2 |
| Molecular Weight | 319.49 g/mol |
| Exact Mass | 319.25 |
| IUPAC Name | [(1R,3aR,4S,7aS)-7a-cyano-1-[(2R)-6-methylheptan-2-yl]-1,2,3,3a,4,5,6,7-octahydroinden-4-yl] acetate |
| SMILES | CC(=O)O[C@H]1CCC[C@]2(C#N)[C@@H]([C@H](C)CCCC(C)C)CC[C@@H]12 |
| InChI | InChI=1S/C20H33NO2/c1-14(2)7-5-8-15(3)17-10-11-18-19(23-16(4)22)9-6-12-20(17,18)13-21/h14-15,17-19H,5-12H2,1-4H3/t15-,17-,18+,19+,20+/m1/s1 |
| InChIKey | ZVQRMDUMDLJASI-LGKHCZOZSA-N |
| XLogP | 5.10 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.49 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |