C11H16N2 — CID 105436645
6-(aminomethyl)-5,6,7,8-tetrahydronaphthalen-1-amine (PubChem CID 105436645) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is 6-(aminomethyl)-5,6,7,8-tetrahydronaphthalen-1-amine.
| Compound Name | 6-(aminomethyl)-5,6,7,8-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 105436645 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 6-(aminomethyl)-5,6,7,8-tetrahydronaphthalen-1-amine |
| SMILES | NCC1CCc2c(N)cccc2C1 |
| InChI | InChI=1S/C11H16N2/c12-7-8-4-5-10-9(6-8)2-1-3-11(10)13/h1-3,8H,4-7,12-13H2 |
| InChIKey | FXJNSOBYBCFFLI-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|