C11H16N2 — CID 105436662
1-N,1-N-dimethyl-2,3-dihydro-1H-indene-1,4-diamine (PubChem CID 105436662) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is 1-N,1-N-dimethyl-2,3-dihydro-1H-indene-1,4-diamine.
| Compound Name | 1-N,1-N-dimethyl-2,3-dihydro-1H-indene-1,4-diamine |
|---|---|
| PubChem CID | 105436662 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 1-N,1-N-dimethyl-2,3-dihydro-1H-indene-1,4-diamine |
| SMILES | CN(C)C1CCc2c(N)cccc21 |
| InChI | InChI=1S/C11H16N2/c1-13(2)11-7-6-8-9(11)4-3-5-10(8)12/h3-5,11H,6-7,12H2,1-2H3 |
| InChIKey | DVFYWGXTZTVTKN-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|