C16H16O7 — CID 10543670
[(1S,2S,6S,9R,10R,11R)-7-oxo-11-phenyl-3,5,8,12-tetraoxatricyclo[7.3.0.02,6]dodecan-10-yl] acetate (PubChem CID 10543670) has the molecular formula C16H16O7 and a molecular weight of 320.30 g/mol. Its IUPAC name is [(1S,2S,6S,9R,10R,11R)-7-oxo-11-phenyl-3,5,8,12-tetraoxatricyclo[7.3.0.02,6]dodecan-10-yl] acetate.
| Compound Name | [(1S,2S,6S,9R,10R,11R)-7-oxo-11-phenyl-3,5,8,12-tetraoxatricyclo[7.3.0.02,6]dodecan-10-yl] acetate |
|---|---|
| PubChem CID | 10543670 |
| Molecular Formula | C16H16O7 |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | [(1S,2S,6S,9R,10R,11R)-7-oxo-11-phenyl-3,5,8,12-tetraoxatricyclo[7.3.0.02,6]dodecan-10-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@@H]2OC(=O)[C@H]3OCO[C@H]3[C@@H]2O[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C16H16O7/c1-8(17)21-12-10(9-5-3-2-4-6-9)22-13-11-15(20-7-19-11)16(18)23-14(12)13/h2-6,10-15H,7H2,1H3/t10-,11+,12-,13+,14+,15+/m1/s1 |
| InChIKey | KXHPETZDYCRUDV-QZOBBIQNSA-N |
| XLogP | 0.73 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |