About 6-propan-2-ylimidazo[1,2-a]pyrimidin-3-ol
6-propan-2-ylimidazo[1,2-a]pyrimidin-3-ol (PubChem CID 105436848) has the molecular formula C9H11N3O
and a molecular weight of 177.21 g/mol. Its IUPAC name is 6-propan-2-ylimidazo[1,2-a]pyrimidin-3-ol.
Molecular Properties
| Compound Name | 6-propan-2-ylimidazo[1,2-a]pyrimidin-3-ol |
| PubChem CID | 105436848 |
| Molecular Formula | C9H11N3O |
| Molecular Weight | 177.21 g/mol |
| Exact Mass | 177.09 |
| IUPAC Name | 6-propan-2-ylimidazo[1,2-a]pyrimidin-3-ol |
| SMILES | CC(C)c1cnc2ncc(O)n2c1 |
| InChI | InChI=1S/C9H11N3O/c1-6(2)7-3-10-9-11-4-8(13)12(9)5-7/h3-6,13H,1-2H3 |
| InChIKey | PLUVKLRPBZHEQD-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 50.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.21 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-propan-2-ylimidazo[1,2-a]pyrimidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-propan-2-ylimidazo[1,2-a]pyrimidin-3-ol?
The IUPAC name of 6-propan-2-ylimidazo[1,2-a]pyrimidin-3-ol (CID 105436848) is 6-propan-2-ylimidazo[1,2-a]pyrimidin-3-ol.
What is the SMILES notation for 6-propan-2-ylimidazo[1,2-a]pyrimidin-3-ol?
The canonical SMILES for 6-propan-2-ylimidazo[1,2-a]pyrimidin-3-ol is CC(C)c1cnc2ncc(O)n2c1.
What is the InChIKey of 6-propan-2-ylimidazo[1,2-a]pyrimidin-3-ol?
The InChIKey is PLUVKLRPBZHEQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3O/c1-6(2)7-3-10-9-11-4-8(13)12(9)5-7/h3-6,13H,1-2H3.
What are the key properties of 6-propan-2-ylimidazo[1,2-a]pyrimidin-3-ol?
6-propan-2-ylimidazo[1,2-a]pyrimidin-3-ol has a molecular weight of 177.21 g/mol, XLogP of 1.56, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-propan-2-ylimidazo[1,2-a]pyrimidin-3-ol is sourced from PubChem (CID 105436848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).