C9H11N3O — CID 105436864
5-cyclopentyl-1,2,4-triazine-3-carbaldehyde (PubChem CID 105436864) has the molecular formula C9H11N3O and a molecular weight of 177.21 g/mol. Its IUPAC name is 5-cyclopentyl-1,2,4-triazine-3-carbaldehyde.
| Compound Name | 5-cyclopentyl-1,2,4-triazine-3-carbaldehyde |
|---|---|
| PubChem CID | 105436864 |
| Molecular Formula | C9H11N3O |
| Molecular Weight | 177.21 g/mol |
| Exact Mass | 177.09 |
| IUPAC Name | 5-cyclopentyl-1,2,4-triazine-3-carbaldehyde |
| SMILES | O=Cc1nncc(C2CCCC2)n1 |
| InChI | InChI=1S/C9H11N3O/c13-6-9-11-8(5-10-12-9)7-3-1-2-4-7/h5-7H,1-4H2 |
| InChIKey | HGACCYOFTBMSLH-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 55.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.21 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|