About 2-(isocyanatomethyl)-6,6-dimethylbicyclo[3.1.1]hept-2-ene
2-(isocyanatomethyl)-6,6-dimethylbicyclo[3.1.1]hept-2-ene (PubChem CID 105437148) has the molecular formula C11H15NO
and a molecular weight of 177.25 g/mol. Its IUPAC name is 2-(isocyanatomethyl)-6,6-dimethylbicyclo[3.1.1]hept-2-ene.
Molecular Properties
| Compound Name | 2-(isocyanatomethyl)-6,6-dimethylbicyclo[3.1.1]hept-2-ene |
| PubChem CID | 105437148 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | 2-(isocyanatomethyl)-6,6-dimethylbicyclo[3.1.1]hept-2-ene |
| SMILES | CC1(C)C2CC=C(CN=C=O)C1C2 |
| InChI | InChI=1S/C11H15NO/c1-11(2)9-4-3-8(6-12-7-13)10(11)5-9/h3,9-10H,4-6H2,1-2H3 |
| InChIKey | YLPOASDZIRUPNO-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(isocyanatomethyl)-6,6-dimethylbicyclo[3.1.1]hept-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(isocyanatomethyl)-6,6-dimethylbicyclo[3.1.1]hept-2-ene?
The IUPAC name of 2-(isocyanatomethyl)-6,6-dimethylbicyclo[3.1.1]hept-2-ene (CID 105437148) is 2-(isocyanatomethyl)-6,6-dimethylbicyclo[3.1.1]hept-2-ene.
What is the SMILES notation for 2-(isocyanatomethyl)-6,6-dimethylbicyclo[3.1.1]hept-2-ene?
The canonical SMILES for 2-(isocyanatomethyl)-6,6-dimethylbicyclo[3.1.1]hept-2-ene is CC1(C)C2CC=C(CN=C=O)C1C2.
What is the InChIKey of 2-(isocyanatomethyl)-6,6-dimethylbicyclo[3.1.1]hept-2-ene?
The InChIKey is YLPOASDZIRUPNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO/c1-11(2)9-4-3-8(6-12-7-13)10(11)5-9/h3,9-10H,4-6H2,1-2H3.
What are the key properties of 2-(isocyanatomethyl)-6,6-dimethylbicyclo[3.1.1]hept-2-ene?
2-(isocyanatomethyl)-6,6-dimethylbicyclo[3.1.1]hept-2-ene has a molecular weight of 177.25 g/mol, XLogP of 2.31, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(isocyanatomethyl)-6,6-dimethylbicyclo[3.1.1]hept-2-ene is sourced from PubChem (CID 105437148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).