About 3-bromo-5-ethyl-4,5-dihydro-1,2-oxazole
3-bromo-5-ethyl-4,5-dihydro-1,2-oxazole (PubChem CID 105437258) has the molecular formula C5H8BrNO
and a molecular weight of 178.03 g/mol. Its IUPAC name is 3-bromo-5-ethyl-4,5-dihydro-1,2-oxazole.
Molecular Properties
| Compound Name | 3-bromo-5-ethyl-4,5-dihydro-1,2-oxazole |
| PubChem CID | 105437258 |
| Molecular Formula | C5H8BrNO |
| Molecular Weight | 178.03 g/mol |
| Exact Mass | 176.98 |
| IUPAC Name | 3-bromo-5-ethyl-4,5-dihydro-1,2-oxazole |
| SMILES | CCC1CC(Br)=NO1 |
| InChI | InChI=1S/C5H8BrNO/c1-2-4-3-5(6)7-8-4/h4H,2-3H2,1H3 |
| InChIKey | DEWCGIVPTFMLPB-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.03 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-bromo-5-ethyl-4,5-dihydro-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-5-ethyl-4,5-dihydro-1,2-oxazole?
The IUPAC name of 3-bromo-5-ethyl-4,5-dihydro-1,2-oxazole (CID 105437258) is 3-bromo-5-ethyl-4,5-dihydro-1,2-oxazole.
What is the SMILES notation for 3-bromo-5-ethyl-4,5-dihydro-1,2-oxazole?
The canonical SMILES for 3-bromo-5-ethyl-4,5-dihydro-1,2-oxazole is CCC1CC(Br)=NO1.
What is the InChIKey of 3-bromo-5-ethyl-4,5-dihydro-1,2-oxazole?
The InChIKey is DEWCGIVPTFMLPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8BrNO/c1-2-4-3-5(6)7-8-4/h4H,2-3H2,1H3.
What are the key properties of 3-bromo-5-ethyl-4,5-dihydro-1,2-oxazole?
3-bromo-5-ethyl-4,5-dihydro-1,2-oxazole has a molecular weight of 178.03 g/mol, XLogP of 1.89, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-5-ethyl-4,5-dihydro-1,2-oxazole is sourced from PubChem (CID 105437258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).