About 2-(3-aminophenyl)-1,2-oxazolidin-3-one
2-(3-aminophenyl)-1,2-oxazolidin-3-one (PubChem CID 105437344) has the molecular formula C9H10N2O2
and a molecular weight of 178.19 g/mol. Its IUPAC name is 2-(3-aminophenyl)-1,2-oxazolidin-3-one.
Molecular Properties
| Compound Name | 2-(3-aminophenyl)-1,2-oxazolidin-3-one |
| PubChem CID | 105437344 |
| Molecular Formula | C9H10N2O2 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | 2-(3-aminophenyl)-1,2-oxazolidin-3-one |
| SMILES | Nc1cccc(N2OCCC2=O)c1 |
| InChI | InChI=1S/C9H10N2O2/c10-7-2-1-3-8(6-7)11-9(12)4-5-13-11/h1-3,6H,4-5,10H2 |
| InChIKey | MZWNGXFONSSTTM-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-aminophenyl)-1,2-oxazolidin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-aminophenyl)-1,2-oxazolidin-3-one?
The IUPAC name of 2-(3-aminophenyl)-1,2-oxazolidin-3-one (CID 105437344) is 2-(3-aminophenyl)-1,2-oxazolidin-3-one.
What is the SMILES notation for 2-(3-aminophenyl)-1,2-oxazolidin-3-one?
The canonical SMILES for 2-(3-aminophenyl)-1,2-oxazolidin-3-one is Nc1cccc(N2OCCC2=O)c1.
What is the InChIKey of 2-(3-aminophenyl)-1,2-oxazolidin-3-one?
The InChIKey is MZWNGXFONSSTTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O2/c10-7-2-1-3-8(6-7)11-9(12)4-5-13-11/h1-3,6H,4-5,10H2.
What are the key properties of 2-(3-aminophenyl)-1,2-oxazolidin-3-one?
2-(3-aminophenyl)-1,2-oxazolidin-3-one has a molecular weight of 178.19 g/mol, XLogP of 0.94, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-aminophenyl)-1,2-oxazolidin-3-one is sourced from PubChem (CID 105437344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).