About 2-(6-fluoroimidazo[1,5-a]pyridin-3-yl)ethanol
2-(6-fluoroimidazo[1,5-a]pyridin-3-yl)ethanol (PubChem CID 105438568) has the molecular formula C9H9FN2O
and a molecular weight of 180.18 g/mol. Its IUPAC name is 2-(6-fluoroimidazo[1,5-a]pyridin-3-yl)ethanol.
Molecular Properties
| Compound Name | 2-(6-fluoroimidazo[1,5-a]pyridin-3-yl)ethanol |
| PubChem CID | 105438568 |
| Molecular Formula | C9H9FN2O |
| Molecular Weight | 180.18 g/mol |
| Exact Mass | 180.07 |
| IUPAC Name | 2-(6-fluoroimidazo[1,5-a]pyridin-3-yl)ethanol |
| SMILES | OCCc1ncc2ccc(F)cn12 |
| InChI | InChI=1S/C9H9FN2O/c10-7-1-2-8-5-11-9(3-4-13)12(8)6-7/h1-2,5-6,13H,3-4H2 |
| InChIKey | FZUFLDMTNSUJAP-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.18 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(6-fluoroimidazo[1,5-a]pyridin-3-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-fluoroimidazo[1,5-a]pyridin-3-yl)ethanol?
The IUPAC name of 2-(6-fluoroimidazo[1,5-a]pyridin-3-yl)ethanol (CID 105438568) is 2-(6-fluoroimidazo[1,5-a]pyridin-3-yl)ethanol.
What is the SMILES notation for 2-(6-fluoroimidazo[1,5-a]pyridin-3-yl)ethanol?
The canonical SMILES for 2-(6-fluoroimidazo[1,5-a]pyridin-3-yl)ethanol is OCCc1ncc2ccc(F)cn12.
What is the InChIKey of 2-(6-fluoroimidazo[1,5-a]pyridin-3-yl)ethanol?
The InChIKey is FZUFLDMTNSUJAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9FN2O/c10-7-1-2-8-5-11-9(3-4-13)12(8)6-7/h1-2,5-6,13H,3-4H2.
What are the key properties of 2-(6-fluoroimidazo[1,5-a]pyridin-3-yl)ethanol?
2-(6-fluoroimidazo[1,5-a]pyridin-3-yl)ethanol has a molecular weight of 180.18 g/mol, XLogP of 1.01, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-fluoroimidazo[1,5-a]pyridin-3-yl)ethanol is sourced from PubChem (CID 105438568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).