About 2-ethyl-5-methyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-amine
2-ethyl-5-methyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-amine (PubChem CID 105439070) has the molecular formula C9H16N4
and a molecular weight of 180.25 g/mol. Its IUPAC name is 2-ethyl-5-methyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-amine.
Molecular Properties
| Compound Name | 2-ethyl-5-methyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-amine |
| PubChem CID | 105439070 |
| Molecular Formula | C9H16N4 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.14 |
| IUPAC Name | 2-ethyl-5-methyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-amine |
| SMILES | CCn1nc2c(c1N)CN(C)CC2 |
| InChI | InChI=1S/C9H16N4/c1-3-13-9(10)7-6-12(2)5-4-8(7)11-13/h3-6,10H2,1-2H3 |
| InChIKey | KRQWVQWOSHGEHR-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-ethyl-5-methyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-5-methyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-amine?
The IUPAC name of 2-ethyl-5-methyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-amine (CID 105439070) is 2-ethyl-5-methyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-amine.
What is the SMILES notation for 2-ethyl-5-methyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-amine?
The canonical SMILES for 2-ethyl-5-methyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-amine is CCn1nc2c(c1N)CN(C)CC2.
What is the InChIKey of 2-ethyl-5-methyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-amine?
The InChIKey is KRQWVQWOSHGEHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N4/c1-3-13-9(10)7-6-12(2)5-4-8(7)11-13/h3-6,10H2,1-2H3.
What are the key properties of 2-ethyl-5-methyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-amine?
2-ethyl-5-methyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-amine has a molecular weight of 180.25 g/mol, XLogP of 0.47, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-5-methyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-amine is sourced from PubChem (CID 105439070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).