About 1-[2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)ethyl]cyclopropan-1-amine
1-[2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)ethyl]cyclopropan-1-amine (PubChem CID 105439122) has the molecular formula C11H20N2
and a molecular weight of 180.29 g/mol. Its IUPAC name is 1-[2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)ethyl]cyclopropan-1-amine.
Molecular Properties
| Compound Name | 1-[2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)ethyl]cyclopropan-1-amine |
| PubChem CID | 105439122 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | 1-[2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)ethyl]cyclopropan-1-amine |
| SMILES | CN1CCC=C(CCC2(N)CC2)C1 |
| InChI | InChI=1S/C11H20N2/c1-13-8-2-3-10(9-13)4-5-11(12)6-7-11/h3H,2,4-9,12H2,1H3 |
| InChIKey | IWOCWMCJUZFHCH-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)ethyl]cyclopropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)ethyl]cyclopropan-1-amine?
The IUPAC name of 1-[2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)ethyl]cyclopropan-1-amine (CID 105439122) is 1-[2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)ethyl]cyclopropan-1-amine.
What is the SMILES notation for 1-[2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)ethyl]cyclopropan-1-amine?
The canonical SMILES for 1-[2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)ethyl]cyclopropan-1-amine is CN1CCC=C(CCC2(N)CC2)C1.
What is the InChIKey of 1-[2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)ethyl]cyclopropan-1-amine?
The InChIKey is IWOCWMCJUZFHCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2/c1-13-8-2-3-10(9-13)4-5-11(12)6-7-11/h3H,2,4-9,12H2,1H3.
What are the key properties of 1-[2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)ethyl]cyclopropan-1-amine?
1-[2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)ethyl]cyclopropan-1-amine has a molecular weight of 180.29 g/mol, XLogP of 1.52, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)ethyl]cyclopropan-1-amine is sourced from PubChem (CID 105439122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).