About 1-chloropyrrolo[1,2-a]pyrazine-6-carbaldehyde
1-chloropyrrolo[1,2-a]pyrazine-6-carbaldehyde (PubChem CID 105439130) has the molecular formula C8H5ClN2O
and a molecular weight of 180.59 g/mol. Its IUPAC name is 1-chloropyrrolo[1,2-a]pyrazine-6-carbaldehyde.
Molecular Properties
| Compound Name | 1-chloropyrrolo[1,2-a]pyrazine-6-carbaldehyde |
| PubChem CID | 105439130 |
| Molecular Formula | C8H5ClN2O |
| Molecular Weight | 180.59 g/mol |
| Exact Mass | 180.01 |
| IUPAC Name | 1-chloropyrrolo[1,2-a]pyrazine-6-carbaldehyde |
| SMILES | O=Cc1ccc2c(Cl)nccn12 |
| InChI | InChI=1S/C8H5ClN2O/c9-8-7-2-1-6(5-12)11(7)4-3-10-8/h1-5H |
| InChIKey | GYPJGXMCUUWLPZ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.59 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1-chloropyrrolo[1,2-a]pyrazine-6-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloropyrrolo[1,2-a]pyrazine-6-carbaldehyde?
The IUPAC name of 1-chloropyrrolo[1,2-a]pyrazine-6-carbaldehyde (CID 105439130) is 1-chloropyrrolo[1,2-a]pyrazine-6-carbaldehyde.
What is the SMILES notation for 1-chloropyrrolo[1,2-a]pyrazine-6-carbaldehyde?
The canonical SMILES for 1-chloropyrrolo[1,2-a]pyrazine-6-carbaldehyde is O=Cc1ccc2c(Cl)nccn12.
What is the InChIKey of 1-chloropyrrolo[1,2-a]pyrazine-6-carbaldehyde?
The InChIKey is GYPJGXMCUUWLPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5ClN2O/c9-8-7-2-1-6(5-12)11(7)4-3-10-8/h1-5H.
What are the key properties of 1-chloropyrrolo[1,2-a]pyrazine-6-carbaldehyde?
1-chloropyrrolo[1,2-a]pyrazine-6-carbaldehyde has a molecular weight of 180.59 g/mol, XLogP of 1.80, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloropyrrolo[1,2-a]pyrazine-6-carbaldehyde is sourced from PubChem (CID 105439130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).