cyclopent-3-en-1-ylmethanesulfonyl chloride

C6H9ClO2S — CID 105439149

IUPACcyclopent-3-en-1-ylmethanesulfonyl chloride
SMILESO=S(=O)(Cl)CC1CC=CC1
InChIInChI=1S/C6H9ClO2S/c7-10(8,9)5-6-3-1-2-4-6/h1-2,6H,3-5H2
InChIKeyGHTBIBXAVFUVAH-UHFFFAOYSA-N
MW180.66 g/mol
LogP1.52
Rot. Bonds2

About cyclopent-3-en-1-ylmethanesulfonyl chloride

cyclopent-3-en-1-ylmethanesulfonyl chloride (PubChem CID 105439149) has the molecular formula C6H9ClO2S and a molecular weight of 180.66 g/mol. Its IUPAC name is cyclopent-3-en-1-ylmethanesulfonyl chloride.

Molecular Properties

Compound Namecyclopent-3-en-1-ylmethanesulfonyl chloride
PubChem CID105439149
Molecular FormulaC6H9ClO2S
Molecular Weight180.66 g/mol
Exact Mass180.00
IUPAC Namecyclopent-3-en-1-ylmethanesulfonyl chloride
SMILESO=S(=O)(Cl)CC1CC=CC1
InChIInChI=1S/C6H9ClO2S/c7-10(8,9)5-6-3-1-2-4-6/h1-2,6H,3-5H2
InChIKeyGHTBIBXAVFUVAH-UHFFFAOYSA-N
XLogP1.52
TPSA34.14 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500180.66
LogP ≤ 51.52
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze cyclopent-3-en-1-ylmethanesulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of cyclopent-3-en-1-ylmethanesulfonyl chloride?
The IUPAC name of cyclopent-3-en-1-ylmethanesulfonyl chloride (CID 105439149) is cyclopent-3-en-1-ylmethanesulfonyl chloride.
What is the SMILES notation for cyclopent-3-en-1-ylmethanesulfonyl chloride?
The canonical SMILES for cyclopent-3-en-1-ylmethanesulfonyl chloride is O=S(=O)(Cl)CC1CC=CC1.
What is the InChIKey of cyclopent-3-en-1-ylmethanesulfonyl chloride?
The InChIKey is GHTBIBXAVFUVAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9ClO2S/c7-10(8,9)5-6-3-1-2-4-6/h1-2,6H,3-5H2.
What are the key properties of cyclopent-3-en-1-ylmethanesulfonyl chloride?
cyclopent-3-en-1-ylmethanesulfonyl chloride has a molecular weight of 180.66 g/mol, XLogP of 1.52, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopent-3-en-1-ylmethanesulfonyl chloride is sourced from PubChem (CID 105439149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).