C10H15NO2 — CID 105439475
3-cyclobutyl-3-azabicyclo[3.1.0]hexane-2-carboxylic acid (PubChem CID 105439475) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is 3-cyclobutyl-3-azabicyclo[3.1.0]hexane-2-carboxylic acid.
| Compound Name | 3-cyclobutyl-3-azabicyclo[3.1.0]hexane-2-carboxylic acid |
|---|---|
| PubChem CID | 105439475 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | 3-cyclobutyl-3-azabicyclo[3.1.0]hexane-2-carboxylic acid |
| SMILES | O=C(O)C1C2CC2CN1C1CCC1 |
| InChI | InChI=1S/C10H15NO2/c12-10(13)9-8-4-6(8)5-11(9)7-2-1-3-7/h6-9H,1-5H2,(H,12,13) |
| InChIKey | VAQZDMKXTZFWMW-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |