About 3-(2-methylsulfinylethyl)-6-(trifluoromethoxy)-1,3-benzothiazol-2-imine
3-(2-methylsulfinylethyl)-6-(trifluoromethoxy)-1,3-benzothiazol-2-imine (PubChem CID 10543960) has the molecular formula C11H11F3N2O2S2
and a molecular weight of 324.35 g/mol. Its IUPAC name is 3-(2-methylsulfinylethyl)-6-(trifluoromethoxy)-1,3-benzothiazol-2-imine.
Molecular Properties
| Compound Name | 3-(2-methylsulfinylethyl)-6-(trifluoromethoxy)-1,3-benzothiazol-2-imine |
| PubChem CID | 10543960 |
| Molecular Formula | C11H11F3N2O2S2 |
| Molecular Weight | 324.35 g/mol |
| Exact Mass | 324.02 |
| IUPAC Name | 3-(2-methylsulfinylethyl)-6-(trifluoromethoxy)-1,3-benzothiazol-2-imine |
| SMILES | [H]/N=c1\sc2cc(OC(F)(F)F)ccc2n1CCS(C)=O |
| InChI | InChI=1S/C11H11F3N2O2S2/c1-20(17)5-4-16-8-3-2-7(18-11(12,13)14)6-9(8)19-10(16)15/h2-3,6,15H,4-5H2,1H3/b15-10- |
| InChIKey | LRGODYPLNAVOAD-GDNBJRDFSA-N |
| XLogP | 2.46 |
| TPSA | 55.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.35 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(2-methylsulfinylethyl)-6-(trifluoromethoxy)-1,3-benzothiazol-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-methylsulfinylethyl)-6-(trifluoromethoxy)-1,3-benzothiazol-2-imine?
The IUPAC name of 3-(2-methylsulfinylethyl)-6-(trifluoromethoxy)-1,3-benzothiazol-2-imine (CID 10543960) is 3-(2-methylsulfinylethyl)-6-(trifluoromethoxy)-1,3-benzothiazol-2-imine.
What is the SMILES notation for 3-(2-methylsulfinylethyl)-6-(trifluoromethoxy)-1,3-benzothiazol-2-imine?
The canonical SMILES for 3-(2-methylsulfinylethyl)-6-(trifluoromethoxy)-1,3-benzothiazol-2-imine is [H]/N=c1\sc2cc(OC(F)(F)F)ccc2n1CCS(C)=O.
What is the InChIKey of 3-(2-methylsulfinylethyl)-6-(trifluoromethoxy)-1,3-benzothiazol-2-imine?
The InChIKey is LRGODYPLNAVOAD-GDNBJRDFSA-N. The full InChI is InChI=1S/C11H11F3N2O2S2/c1-20(17)5-4-16-8-3-2-7(18-11(12,13)14)6-9(8)19-10(16)15/h2-3,6,15H,4-5H2,1H3/b15-10-.
What are the key properties of 3-(2-methylsulfinylethyl)-6-(trifluoromethoxy)-1,3-benzothiazol-2-imine?
3-(2-methylsulfinylethyl)-6-(trifluoromethoxy)-1,3-benzothiazol-2-imine has a molecular weight of 324.35 g/mol, XLogP of 2.46, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-methylsulfinylethyl)-6-(trifluoromethoxy)-1,3-benzothiazol-2-imine is sourced from PubChem (CID 10543960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).