About 1-ethyl-4-fluoro-5,6-dihydro-4H-cyclopenta[c]pyrazole-3-carbaldehyde
1-ethyl-4-fluoro-5,6-dihydro-4H-cyclopenta[c]pyrazole-3-carbaldehyde (PubChem CID 105439972) has the molecular formula C9H11FN2O
and a molecular weight of 182.20 g/mol. Its IUPAC name is 1-ethyl-4-fluoro-5,6-dihydro-4H-cyclopenta[c]pyrazole-3-carbaldehyde.
Molecular Properties
| Compound Name | 1-ethyl-4-fluoro-5,6-dihydro-4H-cyclopenta[c]pyrazole-3-carbaldehyde |
| PubChem CID | 105439972 |
| Molecular Formula | C9H11FN2O |
| Molecular Weight | 182.20 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 1-ethyl-4-fluoro-5,6-dihydro-4H-cyclopenta[c]pyrazole-3-carbaldehyde |
| SMILES | CCn1nc(C=O)c2c1CCC2F |
| InChI | InChI=1S/C9H11FN2O/c1-2-12-8-4-3-6(10)9(8)7(5-13)11-12/h5-6H,2-4H2,1H3 |
| InChIKey | RQNGPBSVOFRYII-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.20 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-4-fluoro-5,6-dihydro-4H-cyclopenta[c]pyrazole-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-4-fluoro-5,6-dihydro-4H-cyclopenta[c]pyrazole-3-carbaldehyde?
The IUPAC name of 1-ethyl-4-fluoro-5,6-dihydro-4H-cyclopenta[c]pyrazole-3-carbaldehyde (CID 105439972) is 1-ethyl-4-fluoro-5,6-dihydro-4H-cyclopenta[c]pyrazole-3-carbaldehyde.
What is the SMILES notation for 1-ethyl-4-fluoro-5,6-dihydro-4H-cyclopenta[c]pyrazole-3-carbaldehyde?
The canonical SMILES for 1-ethyl-4-fluoro-5,6-dihydro-4H-cyclopenta[c]pyrazole-3-carbaldehyde is CCn1nc(C=O)c2c1CCC2F.
What is the InChIKey of 1-ethyl-4-fluoro-5,6-dihydro-4H-cyclopenta[c]pyrazole-3-carbaldehyde?
The InChIKey is RQNGPBSVOFRYII-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11FN2O/c1-2-12-8-4-3-6(10)9(8)7(5-13)11-12/h5-6H,2-4H2,1H3.
What are the key properties of 1-ethyl-4-fluoro-5,6-dihydro-4H-cyclopenta[c]pyrazole-3-carbaldehyde?
1-ethyl-4-fluoro-5,6-dihydro-4H-cyclopenta[c]pyrazole-3-carbaldehyde has a molecular weight of 182.20 g/mol, XLogP of 1.67, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-4-fluoro-5,6-dihydro-4H-cyclopenta[c]pyrazole-3-carbaldehyde is sourced from PubChem (CID 105439972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).