C13H15N3O5S — CID 10544032
N-(diaminomethylidene)-5'-methyl-1',1'-dioxospiro[1,3-dioxolane-2,3'-2H-1-benzothiophene]-6'-carboxamide (PubChem CID 10544032) has the molecular formula C13H15N3O5S and a molecular weight of 325.35 g/mol. Its IUPAC name is N-(diaminomethylidene)-5'-methyl-1',1'-dioxospiro[1,3-dioxolane-2,3'-2H-1-benzothiophene]-6'-carboxamide.
| Compound Name | N-(diaminomethylidene)-5'-methyl-1',1'-dioxospiro[1,3-dioxolane-2,3'-2H-1-benzothiophene]-6'-carboxamide |
|---|---|
| PubChem CID | 10544032 |
| Molecular Formula | C13H15N3O5S |
| Molecular Weight | 325.35 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | N-(diaminomethylidene)-5'-methyl-1',1'-dioxospiro[1,3-dioxolane-2,3'-2H-1-benzothiophene]-6'-carboxamide |
| SMILES | Cc1cc2c(cc1C(=O)N=C(N)N)S(=O)(=O)CC21OCCO1 |
| InChI | InChI=1S/C13H15N3O5S/c1-7-4-9-10(5-8(7)11(17)16-12(14)15)22(18,19)6-13(9)20-2-3-21-13/h4-5H,2-3,6H2,1H3,(H4,14,15,16,17) |
| InChIKey | RGMZCEYXLNCXKJ-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 134.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.35 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|