C18H19N3O3 — CID 10544038
5-(4-nitrophenyl)-2-[(1Z,3E)-4-piperidin-1-ylbuta-1,3-dienyl]-1,3-oxazole (PubChem CID 10544038) has the molecular formula C18H19N3O3 and a molecular weight of 325.37 g/mol. Its IUPAC name is 5-(4-nitrophenyl)-2-[(1Z,3E)-4-piperidin-1-ylbuta-1,3-dienyl]-1,3-oxazole.
| Compound Name | 5-(4-nitrophenyl)-2-[(1Z,3E)-4-piperidin-1-ylbuta-1,3-dienyl]-1,3-oxazole |
|---|---|
| PubChem CID | 10544038 |
| Molecular Formula | C18H19N3O3 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | 5-(4-nitrophenyl)-2-[(1Z,3E)-4-piperidin-1-ylbuta-1,3-dienyl]-1,3-oxazole |
| SMILES | O=[N+]([O-])c1ccc(-c2cnc(/C=C\C=C\N3CCCCC3)o2)cc1 |
| InChI | InChI=1S/C18H19N3O3/c22-21(23)16-9-7-15(8-10-16)17-14-19-18(24-17)6-2-5-13-20-11-3-1-4-12-20/h2,5-10,13-14H,1,3-4,11-12H2/b6-2-,13-5+ |
| InChIKey | LJFUMVILZUJMLK-HJQJQFSFSA-N |
| XLogP | 4.26 |
| TPSA | 72.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|