C20H23NO3 — CID 10544050
(2S,5R,6S)-2-benzyl-4-(methoxymethyl)-5-methyl-6-phenylmorpholin-3-one (PubChem CID 10544050) has the molecular formula C20H23NO3 and a molecular weight of 325.41 g/mol. Its IUPAC name is (2S,5R,6S)-2-benzyl-4-(methoxymethyl)-5-methyl-6-phenylmorpholin-3-one.
| Compound Name | (2S,5R,6S)-2-benzyl-4-(methoxymethyl)-5-methyl-6-phenylmorpholin-3-one |
|---|---|
| PubChem CID | 10544050 |
| Molecular Formula | C20H23NO3 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | (2S,5R,6S)-2-benzyl-4-(methoxymethyl)-5-methyl-6-phenylmorpholin-3-one |
| SMILES | COCN1C(=O)[C@H](Cc2ccccc2)O[C@@H](c2ccccc2)[C@H]1C |
| InChI | InChI=1S/C20H23NO3/c1-15-19(17-11-7-4-8-12-17)24-18(20(22)21(15)14-23-2)13-16-9-5-3-6-10-16/h3-12,15,18-19H,13-14H2,1-2H3/t15-,18+,19-/m1/s1 |
| InChIKey | VMHQHUOETPUNCR-AYOQOUSVSA-N |
| XLogP | 3.19 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |