C10H18N2O8S — CID 10544095
(2R,3R,4S)-4-amino-3-(methanesulfonamido)-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylic acid (PubChem CID 10544095) has the molecular formula C10H18N2O8S and a molecular weight of 326.33 g/mol. Its IUPAC name is (2R,3R,4S)-4-amino-3-(methanesulfonamido)-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylic acid.
| Compound Name | (2R,3R,4S)-4-amino-3-(methanesulfonamido)-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylic acid |
|---|---|
| PubChem CID | 10544095 |
| Molecular Formula | C10H18N2O8S |
| Molecular Weight | 326.33 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | (2R,3R,4S)-4-amino-3-(methanesulfonamido)-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylic acid |
| SMILES | CS(=O)(=O)N[C@H]1[C@H]([C@H](O)[C@H](O)CO)OC(C(=O)O)=C[C@@H]1N |
| InChI | InChI=1S/C10H18N2O8S/c1-21(18,19)12-7-4(11)2-6(10(16)17)20-9(7)8(15)5(14)3-13/h2,4-5,7-9,12-15H,3,11H2,1H3,(H,16,17)/t4-,5+,7+,8+,9+/m0/s1 |
| InChIKey | YSERTFNMYVSHSA-FVDCJOIDSA-N |
| XLogP | -3.69 |
| TPSA | 179.41 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.33 |
| LogP ≤ 5 | -3.69 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |