5-methyl-3-oxo-2,5-diazabicyclo[2.2.2]octane-1-carboxylic acid

C8H12N2O3 — CID 105440991

IUPAC5-methyl-3-oxo-2,5-diazabicyclo[2.2.2]octane-1-carboxylic acid
SMILESCN1CC2(C(=O)O)CCC1C(=O)N2
InChIInChI=1S/C8H12N2O3/c1-10-4-8(7(12)13)3-2-5(10)6(11)9-8/h5H,2-4H2,1H3,(H,9,11)(H,12,13)
InChIKeyYIBLZRCIXQWIHB-UHFFFAOYSA-N
MW184.19 g/mol
LogP-0.97
Rot. Bonds1

About 5-methyl-3-oxo-2,5-diazabicyclo[2.2.2]octane-1-carboxylic acid

5-methyl-3-oxo-2,5-diazabicyclo[2.2.2]octane-1-carboxylic acid (PubChem CID 105440991) has the molecular formula C8H12N2O3 and a molecular weight of 184.19 g/mol. Its IUPAC name is 5-methyl-3-oxo-2,5-diazabicyclo[2.2.2]octane-1-carboxylic acid.

Molecular Properties

Compound Name5-methyl-3-oxo-2,5-diazabicyclo[2.2.2]octane-1-carboxylic acid
PubChem CID105440991
Molecular FormulaC8H12N2O3
Molecular Weight184.19 g/mol
Exact Mass184.08
IUPAC Name5-methyl-3-oxo-2,5-diazabicyclo[2.2.2]octane-1-carboxylic acid
SMILESCN1CC2(C(=O)O)CCC1C(=O)N2
InChIInChI=1S/C8H12N2O3/c1-10-4-8(7(12)13)3-2-5(10)6(11)9-8/h5H,2-4H2,1H3,(H,9,11)(H,12,13)
InChIKeyYIBLZRCIXQWIHB-UHFFFAOYSA-N
XLogP-0.97
TPSA69.64 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500184.19
LogP ≤ 5-0.97
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 5-methyl-3-oxo-2,5-diazabicyclo[2.2.2]octane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-methyl-3-oxo-2,5-diazabicyclo[2.2.2]octane-1-carboxylic acid?
The IUPAC name of 5-methyl-3-oxo-2,5-diazabicyclo[2.2.2]octane-1-carboxylic acid (CID 105440991) is 5-methyl-3-oxo-2,5-diazabicyclo[2.2.2]octane-1-carboxylic acid.
What is the SMILES notation for 5-methyl-3-oxo-2,5-diazabicyclo[2.2.2]octane-1-carboxylic acid?
The canonical SMILES for 5-methyl-3-oxo-2,5-diazabicyclo[2.2.2]octane-1-carboxylic acid is CN1CC2(C(=O)O)CCC1C(=O)N2.
What is the InChIKey of 5-methyl-3-oxo-2,5-diazabicyclo[2.2.2]octane-1-carboxylic acid?
The InChIKey is YIBLZRCIXQWIHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O3/c1-10-4-8(7(12)13)3-2-5(10)6(11)9-8/h5H,2-4H2,1H3,(H,9,11)(H,12,13).
What are the key properties of 5-methyl-3-oxo-2,5-diazabicyclo[2.2.2]octane-1-carboxylic acid?
5-methyl-3-oxo-2,5-diazabicyclo[2.2.2]octane-1-carboxylic acid has a molecular weight of 184.19 g/mol, XLogP of -0.97, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-3-oxo-2,5-diazabicyclo[2.2.2]octane-1-carboxylic acid is sourced from PubChem (CID 105440991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).